C25H32Cl2N2O2 — CID 156773266
[(1R)-4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium-1-yl]methyl acetate chloride (PubChem CID 156773266) has the molecular formula C25H32Cl2N2O2 and a molecular weight of 463.45 g/mol. Its IUPAC name is [(1R)-4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium-1-yl]methyl acetate chloride.
| Compound Name | [(1R)-4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium-1-yl]methyl acetate chloride |
|---|---|
| PubChem CID | 156773266 |
| Molecular Formula | C25H32Cl2N2O2 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | [(1R)-4-[(1R,3S)-6-chloro-3-phenyl-2,3-dihydro-1H-inden-1-yl]-1,2,2-trimethylpiperazin-1-ium-1-yl]methyl acetate chloride |
| SMILES | CC(=O)OC[N@+]1(C)CCN([C@@H]2C[C@@H](c3ccccc3)c3ccc(Cl)cc32)CC1(C)C.[Cl-] |
| InChI | InChI=1S/C25H32ClN2O2.ClH/c1-18(29)30-17-28(4)13-12-27(16-25(28,2)3)24-15-22(19-8-6-5-7-9-19)21-11-10-20(26)14-23(21)24;/h5-11,14,22,24H,12-13,15-17H2,1-4H3;1H/q+1;/p-1/t22-,24+,28-;/m0./s1 |
| InChIKey | LABIBWHGCFUENL-GYVWQQPGSA-M |
| XLogP | 1.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|