C22H24ClFN5O2+ — CID 87782049
(2R)-1-[[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]-1-methylpyrrolidin-1-ium-2-carboxamide (PubChem CID 87782049) has the molecular formula C22H24ClFN5O2+ and a molecular weight of 444.92 g/mol. Its IUPAC name is (2R)-1-[[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]-1-methylpyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2R)-1-[[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]-1-methylpyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 87782049 |
| Molecular Formula | C22H24ClFN5O2+ |
| Molecular Weight | 444.92 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (2R)-1-[[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]methyl]-1-methylpyrrolidin-1-ium-2-carboxamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1C[N+]1(C)CCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C22H23ClFN5O2/c1-29(7-3-4-19(29)21(25)30)11-13-8-15-18(10-20(13)31-2)26-12-27-22(15)28-14-5-6-17(24)16(23)9-14/h5-6,8-10,12,19H,3-4,7,11H2,1-2H3,(H2-,25,26,27,28,30)/p+1/t19-,29?/m1/s1 |
| InChIKey | NZIDLSXBLKFYJR-COBFLCELSA-O |
| XLogP | 3.77 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|