About [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate
[(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate (PubChem CID 87786699) has the molecular formula C27H25AsO3
and a molecular weight of 472.42 g/mol. Its IUPAC name is [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate.
Molecular Properties
| Compound Name | [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate |
| PubChem CID | 87786699 |
| Molecular Formula | C27H25AsO3 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate |
| SMILES | COc1ccc([As](OC(C)=O)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25AsO3/c1-22(29)31-28(23-12-6-3-7-13-23,24-14-8-4-9-15-24,25-16-10-5-11-17-25)26-18-20-27(30-2)21-19-26/h3-21H,1-2H3 |
| InChIKey | JEYQDQDBPSGYGU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate?
The IUPAC name of [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate (CID 87786699) is [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate.
What is the SMILES notation for [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate?
The canonical SMILES for [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate is COc1ccc([As](OC(C)=O)(c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate?
The InChIKey is JEYQDQDBPSGYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H25AsO3/c1-22(29)31-28(23-12-6-3-7-13-23,24-14-8-4-9-15-24,25-16-10-5-11-17-25)26-18-20-27(30-2)21-19-26/h3-21H,1-2H3.
What are the key properties of [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate?
[(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate has a molecular weight of 472.42 g/mol, XLogP of 3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-methoxyphenyl)-triphenyl-λ5-arsanyl] acetate is sourced from PubChem (CID 87786699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).