C21H23F3N2O4 — CID 87787536
[[methoxy-[3-(trifluoromethyl)phenyl]carbamoyl]amino] 3,3-dimethyl-2-phenylbutanoate (PubChem CID 87787536) has the molecular formula C21H23F3N2O4 and a molecular weight of 424.42 g/mol. Its IUPAC name is [[methoxy-[3-(trifluoromethyl)phenyl]carbamoyl]amino] 3,3-dimethyl-2-phenylbutanoate.
| Compound Name | [[methoxy-[3-(trifluoromethyl)phenyl]carbamoyl]amino] 3,3-dimethyl-2-phenylbutanoate |
|---|---|
| PubChem CID | 87787536 |
| Molecular Formula | C21H23F3N2O4 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [[methoxy-[3-(trifluoromethyl)phenyl]carbamoyl]amino] 3,3-dimethyl-2-phenylbutanoate |
| SMILES | CON(C(=O)NOC(=O)C(c1ccccc1)C(C)(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H23F3N2O4/c1-20(2,3)17(14-9-6-5-7-10-14)18(27)30-25-19(28)26(29-4)16-12-8-11-15(13-16)21(22,23)24/h5-13,17H,1-4H3,(H,25,28) |
| InChIKey | HFOYDPKGVGCMQE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|