About [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate
[4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate (PubChem CID 87788120) has the molecular formula C26H26O5
and a molecular weight of 418.49 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate.
Molecular Properties
| Compound Name | [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate |
| PubChem CID | 87788120 |
| Molecular Formula | C26H26O5 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate |
| SMILES | CCCOc1ccccc1C(=O)OC(=O)Oc1ccc(C(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26O5/c1-4-18-29-23-13-9-8-12-22(23)24(27)31-25(28)30-21-16-14-20(15-17-21)26(2,3)19-10-6-5-7-11-19/h5-17H,4,18H2,1-3H3 |
| InChIKey | GHZYIOVPADLWJU-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate?
The IUPAC name of [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate (CID 87788120) is [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate.
What is the SMILES notation for [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate?
The canonical SMILES for [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate is CCCOc1ccccc1C(=O)OC(=O)Oc1ccc(C(C)(C)c2ccccc2)cc1.
What is the InChIKey of [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate?
The InChIKey is GHZYIOVPADLWJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26O5/c1-4-18-29-23-13-9-8-12-22(23)24(27)31-25(28)30-21-16-14-20(15-17-21)26(2,3)19-10-6-5-7-11-19/h5-17H,4,18H2,1-3H3.
What are the key properties of [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate?
[4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate has a molecular weight of 418.49 g/mol, XLogP of 6.16, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-phenylpropan-2-yl)phenoxy]carbonyl 2-propoxybenzoate is sourced from PubChem (CID 87788120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).