C18H20N2O5S — CID 87793309
7-methoxycarbonyl-7-methyl-4-(phenylmethoxyamino)-4,5-dihydrothieno[2,3-c]pyridine-6-carboxylic acid (PubChem CID 87793309) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is 7-methoxycarbonyl-7-methyl-4-(phenylmethoxyamino)-4,5-dihydrothieno[2,3-c]pyridine-6-carboxylic acid.
| Compound Name | 7-methoxycarbonyl-7-methyl-4-(phenylmethoxyamino)-4,5-dihydrothieno[2,3-c]pyridine-6-carboxylic acid |
|---|---|
| PubChem CID | 87793309 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 7-methoxycarbonyl-7-methyl-4-(phenylmethoxyamino)-4,5-dihydrothieno[2,3-c]pyridine-6-carboxylic acid |
| SMILES | COC(=O)C1(C)c2sccc2C(NOCc2ccccc2)CN1C(=O)O |
| InChI | InChI=1S/C18H20N2O5S/c1-18(16(21)24-2)15-13(8-9-26-15)14(10-20(18)17(22)23)19-25-11-12-6-4-3-5-7-12/h3-9,14,19H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | SXELOPOLMFODRG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|