C15H15BrN2O3S — CID 87714962
3-bromo-7-(phenylmethoxyamino)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylic acid (PubChem CID 87714962) has the molecular formula C15H15BrN2O3S and a molecular weight of 383.27 g/mol. Its IUPAC name is 3-bromo-7-(phenylmethoxyamino)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylic acid.
| Compound Name | 3-bromo-7-(phenylmethoxyamino)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 87714962 |
| Molecular Formula | C15H15BrN2O3S |
| Molecular Weight | 383.27 g/mol |
| Exact Mass | 382.00 |
| IUPAC Name | 3-bromo-7-(phenylmethoxyamino)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylic acid |
| SMILES | O=C(O)C1NCC(NOCc2ccccc2)c2scc(Br)c21 |
| InChI | InChI=1S/C15H15BrN2O3S/c16-10-8-22-14-11(6-17-13(12(10)14)15(19)20)18-21-7-9-4-2-1-3-5-9/h1-5,8,11,13,17-18H,6-7H2,(H,19,20) |
| InChIKey | NCMJSECMVRTGHQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|