C11H24N2O2S3 — CID 87793767
1,1-bis(4-methylsulfinylbutyl)thiourea (PubChem CID 87793767) has the molecular formula C11H24N2O2S3 and a molecular weight of 312.53 g/mol. Its IUPAC name is 1,1-bis(4-methylsulfinylbutyl)thiourea.
| Compound Name | 1,1-bis(4-methylsulfinylbutyl)thiourea |
|---|---|
| PubChem CID | 87793767 |
| Molecular Formula | C11H24N2O2S3 |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 1,1-bis(4-methylsulfinylbutyl)thiourea |
| SMILES | CS(=O)CCCCN(CCCCS(C)=O)C(N)=S |
| InChI | InChI=1S/C11H24N2O2S3/c1-17(14)9-5-3-7-13(11(12)16)8-4-6-10-18(2)15/h3-10H2,1-2H3,(H2,12,16) |
| InChIKey | DZGHTHKFUDKZEB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|