C17H36N2O2S — CID 143080092
1,1-bis(6-hydroxy-5,5-dimethylhexyl)thiourea (PubChem CID 143080092) has the molecular formula C17H36N2O2S and a molecular weight of 332.55 g/mol. Its IUPAC name is 1,1-bis(6-hydroxy-5,5-dimethylhexyl)thiourea.
| Compound Name | 1,1-bis(6-hydroxy-5,5-dimethylhexyl)thiourea |
|---|---|
| PubChem CID | 143080092 |
| Molecular Formula | C17H36N2O2S |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1,1-bis(6-hydroxy-5,5-dimethylhexyl)thiourea |
| SMILES | CC(C)(CO)CCCCN(CCCCC(C)(C)CO)C(N)=S |
| InChI | InChI=1S/C17H36N2O2S/c1-16(2,13-20)9-5-7-11-19(15(18)22)12-8-6-10-17(3,4)14-21/h20-21H,5-14H2,1-4H3,(H2,18,22) |
| InChIKey | XPBUXTZUUJZNIS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|