C15H17N3O3S — CID 87797720
methyl 2-[[(3S)-3-(2-aminophenyl)butanoyl]amino]-1,3-thiazole-4-carboxylate (PubChem CID 87797720) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is methyl 2-[[(3S)-3-(2-aminophenyl)butanoyl]amino]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[[(3S)-3-(2-aminophenyl)butanoyl]amino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 87797720 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl 2-[[(3S)-3-(2-aminophenyl)butanoyl]amino]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1csc(NC(=O)C[C@H](C)c2ccccc2N)n1 |
| InChI | InChI=1S/C15H17N3O3S/c1-9(10-5-3-4-6-11(10)16)7-13(19)18-15-17-12(8-22-15)14(20)21-2/h3-6,8-9H,7,16H2,1-2H3,(H,17,18,19)/t9-/m0/s1 |
| InChIKey | PFRCMVWWKVQBEI-VIFPVBQESA-N |
| XLogP | 2.64 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|