C15H18F3N3O3 — CID 87799303
2-(methylamino)-2-(2-oxoethyl)-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid (PubChem CID 87799303) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 2-(methylamino)-2-(2-oxoethyl)-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid.
| Compound Name | 2-(methylamino)-2-(2-oxoethyl)-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87799303 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-(methylamino)-2-(2-oxoethyl)-4-[2-(trifluoromethyl)phenyl]piperazine-1-carboxylic acid |
| SMILES | CNC1(CC=O)CN(c2ccccc2C(F)(F)F)CCN1C(=O)O |
| InChI | InChI=1S/C15H18F3N3O3/c1-19-14(6-9-22)10-20(7-8-21(14)13(23)24)12-5-3-2-4-11(12)15(16,17)18/h2-5,9,19H,6-8,10H2,1H3,(H,23,24) |
| InChIKey | ZSOJZNFCNXWCIP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|