C17H19ClN4O3 — CID 87798698
4-(5-chloroquinolin-2-yl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid (PubChem CID 87798698) has the molecular formula C17H19ClN4O3 and a molecular weight of 362.82 g/mol. Its IUPAC name is 4-(5-chloroquinolin-2-yl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid.
| Compound Name | 4-(5-chloroquinolin-2-yl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87798698 |
| Molecular Formula | C17H19ClN4O3 |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-(5-chloroquinolin-2-yl)-2-(methylamino)-2-(2-oxoethyl)piperazine-1-carboxylic acid |
| SMILES | CNC1(CC=O)CN(c2ccc3c(Cl)cccc3n2)CCN1C(=O)O |
| InChI | InChI=1S/C17H19ClN4O3/c1-19-17(7-10-23)11-21(8-9-22(17)16(24)25)15-6-5-12-13(18)3-2-4-14(12)20-15/h2-6,10,19H,7-9,11H2,1H3,(H,24,25) |
| InChIKey | QGOOIZQPYPNISF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|