C19H19Br2FO4 — CID 87804956
[3,5-dibromo-4-(3-fluoro-4-methoxy-5-propan-2-ylphenoxy)-2-methylphenyl] acetate (PubChem CID 87804956) has the molecular formula C19H19Br2FO4 and a molecular weight of 490.16 g/mol. Its IUPAC name is [3,5-dibromo-4-(3-fluoro-4-methoxy-5-propan-2-ylphenoxy)-2-methylphenyl] acetate.
| Compound Name | [3,5-dibromo-4-(3-fluoro-4-methoxy-5-propan-2-ylphenoxy)-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 87804956 |
| Molecular Formula | C19H19Br2FO4 |
| Molecular Weight | 490.16 g/mol |
| Exact Mass | 487.96 |
| IUPAC Name | [3,5-dibromo-4-(3-fluoro-4-methoxy-5-propan-2-ylphenoxy)-2-methylphenyl] acetate |
| SMILES | COc1c(F)cc(Oc2c(Br)cc(OC(C)=O)c(C)c2Br)cc1C(C)C |
| InChI | InChI=1S/C19H19Br2FO4/c1-9(2)13-6-12(7-15(22)18(13)24-5)26-19-14(20)8-16(25-11(4)23)10(3)17(19)21/h6-9H,1-5H3 |
| InChIKey | FGSZBOKUZYPPOH-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.16 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|