C20H20Cl3F3N4O — CID 87812708
2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-2-[2-[(2,4-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]acetaldehyde (PubChem CID 87812708) has the molecular formula C20H20Cl3F3N4O and a molecular weight of 495.76 g/mol. Its IUPAC name is 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-2-[2-[(2,4-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]acetaldehyde.
| Compound Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-2-[2-[(2,4-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 87812708 |
| Molecular Formula | C20H20Cl3F3N4O |
| Molecular Weight | 495.76 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | 2-[4-chloro-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-2-[2-[(2,4-dichlorophenyl)methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]acetaldehyde |
| SMILES | Cc1c(Cl)c(C(F)(F)F)nn1C(C=O)N1CC2CN(Cc3ccc(Cl)cc3Cl)CC2C1 |
| InChI | InChI=1S/C20H20Cl3F3N4O/c1-11-18(23)19(20(24,25)26)27-30(11)17(10-31)29-8-13-6-28(7-14(13)9-29)5-12-2-3-15(21)4-16(12)22/h2-4,10,13-14,17H,5-9H2,1H3 |
| InChIKey | AVDFFBIODYPPDG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.76 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|