C11H13IN2O2 — CID 87814354
[3-(iodoamino)-2,3-dihydro-1H-inden-5-yl] N-methylcarbamate (PubChem CID 87814354) has the molecular formula C11H13IN2O2 and a molecular weight of 332.14 g/mol. Its IUPAC name is [3-(iodoamino)-2,3-dihydro-1H-inden-5-yl] N-methylcarbamate.
| Compound Name | [3-(iodoamino)-2,3-dihydro-1H-inden-5-yl] N-methylcarbamate |
|---|---|
| PubChem CID | 87814354 |
| Molecular Formula | C11H13IN2O2 |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | [3-(iodoamino)-2,3-dihydro-1H-inden-5-yl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc2c(c1)C(NI)CC2 |
| InChI | InChI=1S/C11H13IN2O2/c1-13-11(15)16-8-4-2-7-3-5-10(14-12)9(7)6-8/h2,4,6,10,14H,3,5H2,1H3,(H,13,15) |
| InChIKey | JUFBETMNEFVJRS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|