C33H46N2 — CID 87823634
[2-(3-butylphenyl)-3-hexyl-5-(3-hexylphenyl)-4-methylpyrrol-1-ium-1-ylidene]azanide (PubChem CID 87823634) has the molecular formula C33H46N2 and a molecular weight of 470.75 g/mol. Its IUPAC name is [2-(3-butylphenyl)-3-hexyl-5-(3-hexylphenyl)-4-methylpyrrol-1-ium-1-ylidene]azanide.
| Compound Name | [2-(3-butylphenyl)-3-hexyl-5-(3-hexylphenyl)-4-methylpyrrol-1-ium-1-ylidene]azanide |
|---|---|
| PubChem CID | 87823634 |
| Molecular Formula | C33H46N2 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.37 |
| IUPAC Name | [2-(3-butylphenyl)-3-hexyl-5-(3-hexylphenyl)-4-methylpyrrol-1-ium-1-ylidene]azanide |
| SMILES | CCCCCCC1=C(c2cccc(CCCC)c2)[N+](=[N-])C(c2cccc(CCCCCC)c2)=C1C |
| InChI | InChI=1S/C33H46N2/c1-5-8-11-13-18-28-20-15-21-29(24-28)32-26(4)31(23-14-12-9-6-2)33(35(32)34)30-22-16-19-27(25-30)17-10-7-3/h15-16,19-22,24-25H,5-14,17-18,23H2,1-4H3 |
| InChIKey | UVBZNJVDTVUGMT-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 25.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|