C20H14 — CID 87823767
5-methylpentacyclo[9.7.1.02,10.03,7.015,19]nonadeca-1(18),2(10),3(7),5,8,11,13,15(19),16-nonaene (PubChem CID 87823767) has the molecular formula C20H14 and a molecular weight of 254.33 g/mol. Its IUPAC name is 5-methylpentacyclo[9.7.1.02,10.03,7.015,19]nonadeca-1(18),2(10),3(7),5,8,11,13,15(19),16-nonaene.
| Compound Name | 5-methylpentacyclo[9.7.1.02,10.03,7.015,19]nonadeca-1(18),2(10),3(7),5,8,11,13,15(19),16-nonaene |
|---|---|
| PubChem CID | 87823767 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 5-methylpentacyclo[9.7.1.02,10.03,7.015,19]nonadeca-1(18),2(10),3(7),5,8,11,13,15(19),16-nonaene |
| SMILES | CC1=Cc2ccc3c(c2C1)-c1cccc2cccc-3c12 |
| InChI | InChI=1S/C20H14/c1-12-10-14-8-9-16-15-6-2-4-13-5-3-7-17(19(13)15)20(16)18(14)11-12/h2-10H,11H2,1H3 |
| InChIKey | JCGXJRFGQBPMRF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |