About 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride
2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride (PubChem CID 175436495) has the molecular formula C14H12Cl2Ti
and a molecular weight of 299.02 g/mol. Its IUPAC name is 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride.
Molecular Properties
| Compound Name | 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride |
| PubChem CID | 175436495 |
| Molecular Formula | C14H12Cl2Ti |
| Molecular Weight | 299.02 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride |
| SMILES | CC1=Cc2ccc3ccccc3c2C1.[Cl-].[Cl-].[Ti+2] |
| InChI | InChI=1S/C14H12.2ClH.Ti/c1-10-8-12-7-6-11-4-2-3-5-13(11)14(12)9-10;;;/h2-8H,9H2,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | OXPRRQLRWDSYFB-UHFFFAOYSA-L |
| XLogP | -2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.02 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride?
The IUPAC name of 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride (CID 175436495) is 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride.
What is the SMILES notation for 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride?
The canonical SMILES for 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride is CC1=Cc2ccc3ccccc3c2C1.[Cl-].[Cl-].[Ti+2].
What is the InChIKey of 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride?
The InChIKey is OXPRRQLRWDSYFB-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H12.2ClH.Ti/c1-10-8-12-7-6-11-4-2-3-5-13(11)14(12)9-10;;;/h2-8H,9H2,1H3;2*1H;/q;;;+2/p-2.
What are the key properties of 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride?
2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride has a molecular weight of 299.02 g/mol, XLogP of -2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-cyclopenta[a]naphthalene;titanium(2+);dichloride is sourced from PubChem (CID 175436495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).