C13H10N2O3S2 — CID 87830311
8-methyl-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4H-1,4-benzoxazin-3-one (PubChem CID 87830311) has the molecular formula C13H10N2O3S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 8-methyl-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 8-methyl-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 87830311 |
| Molecular Formula | C13H10N2O3S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 8-methyl-6-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cc(C=C2SC(=S)NC2=O)cc2c1OCC(=O)N2 |
| InChI | InChI=1S/C13H10N2O3S2/c1-6-2-7(4-9-12(17)15-13(19)20-9)3-8-11(6)18-5-10(16)14-8/h2-4H,5H2,1H3,(H,14,16)(H,15,17,19) |
| InChIKey | NJHQAUWQDNXOLA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|