C21H23F3N2O3 — CID 87834074
2,2,2-trifluoro-N-(furan-3-ylmethyl)-N-[4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butyl]acetamide (PubChem CID 87834074) has the molecular formula C21H23F3N2O3 and a molecular weight of 408.42 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(furan-3-ylmethyl)-N-[4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-(furan-3-ylmethyl)-N-[4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butyl]acetamide |
|---|---|
| PubChem CID | 87834074 |
| Molecular Formula | C21H23F3N2O3 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 2,2,2-trifluoro-N-(furan-3-ylmethyl)-N-[4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butyl]acetamide |
| SMILES | O=C(CCCN(Cc1ccoc1)C(=O)C(F)(F)F)c1ccc2c(c1)CCNCC2 |
| InChI | InChI=1S/C21H23F3N2O3/c22-21(23,24)20(28)26(13-15-7-11-29-14-15)10-1-2-19(27)18-4-3-16-5-8-25-9-6-17(16)12-18/h3-4,7,11-12,14,25H,1-2,5-6,8-10,13H2 |
| InChIKey | VJYKFERNXCDBOD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |