C26H31F3N2O4 — CID 87833631
N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoro-N-[4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butyl]acetamide (PubChem CID 87833631) has the molecular formula C26H31F3N2O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoro-N-[4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butyl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoro-N-[4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butyl]acetamide |
|---|---|
| PubChem CID | 87833631 |
| Molecular Formula | C26H31F3N2O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2,2,2-trifluoro-N-[4-oxo-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butyl]acetamide |
| SMILES | COc1ccc(CCN(CCCC(=O)c2ccc3c(c2)CCNCC3)C(=O)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C26H31F3N2O4/c1-34-23-8-5-18(16-24(23)35-2)11-15-31(25(33)26(27,28)29)14-3-4-22(32)21-7-6-19-9-12-30-13-10-20(19)17-21/h5-8,16-17,30H,3-4,9-15H2,1-2H3 |
| InChIKey | APFXHKYDPOXVAX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |