C24H28F3N3O4 — CID 21108455
N-ethyl-4-oxo-N-(pyridin-4-ylmethyl)-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butanamide;2,2,2-trifluoroacetic acid (PubChem CID 21108455) has the molecular formula C24H28F3N3O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is N-ethyl-4-oxo-N-(pyridin-4-ylmethyl)-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-ethyl-4-oxo-N-(pyridin-4-ylmethyl)-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 21108455 |
| Molecular Formula | C24H28F3N3O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | N-ethyl-4-oxo-N-(pyridin-4-ylmethyl)-4-(2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl)butanamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(Cc1ccncc1)C(=O)CCC(=O)c1ccc2c(c1)CCNCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27N3O2.C2HF3O2/c1-2-25(16-17-7-11-23-12-8-17)22(27)6-5-21(26)20-4-3-18-9-13-24-14-10-19(18)15-20;3-2(4,5)1(6)7/h3-4,7-8,11-12,15,24H,2,5-6,9-10,13-14,16H2,1H3;(H,6,7) |
| InChIKey | QRKJPHCOUSJASL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |