C17H20O4S — CID 87836982
[3-(2,4-dideuterio-6-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)propyl] methanesulfonate (PubChem CID 87836982) has the molecular formula C17H20O4S and a molecular weight of 327.45 g/mol. Its IUPAC name is [3-(2,4-dideuterio-6-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)propyl] methanesulfonate.
| Compound Name | [3-(2,4-dideuterio-6-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)propyl] methanesulfonate |
|---|---|
| PubChem CID | 87836982 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | [3-(2,4-dideuterio-6-methylphenoxy)-3-(2,3,4,5,6-pentadeuteriophenyl)propyl] methanesulfonate |
| SMILES | [2H]c1cc([2H])c(OC(CCOS(C)(=O)=O)c2c([2H])c([2H])c([2H])c([2H])c2[2H])c(C)c1 |
| InChI | InChI=1S/C17H20O4S/c1-14-8-6-7-11-16(14)21-17(12-13-20-22(2,18)19)15-9-4-3-5-10-15/h3-11,17H,12-13H2,1-2H3/i3D,4D,5D,6D,9D,10D,11D |
| InChIKey | OPWPJVYHJPTAOJ-YPACFWETSA-N |
| XLogP | 3.48 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|