C31H30ClN5OS — CID 87843059
5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine;O-naphthalen-2-yl N-methyl-N-(3-methylphenyl)carbamothioate (PubChem CID 87843059) has the molecular formula C31H30ClN5OS and a molecular weight of 556.14 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine;O-naphthalen-2-yl N-methyl-N-(3-methylphenyl)carbamothioate.
| Compound Name | 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine;O-naphthalen-2-yl N-methyl-N-(3-methylphenyl)carbamothioate |
|---|---|
| PubChem CID | 87843059 |
| Molecular Formula | C31H30ClN5OS |
| Molecular Weight | 556.14 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | 5-(4-chlorophenyl)-6-ethylpyrimidine-2,4-diamine;O-naphthalen-2-yl N-methyl-N-(3-methylphenyl)carbamothioate |
| SMILES | CCc1nc(N)nc(N)c1-c1ccc(Cl)cc1.Cc1cccc(N(C)C(=S)Oc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C19H17NOS.C12H13ClN4/c1-14-6-5-9-17(12-14)20(2)19(22)21-18-11-10-15-7-3-4-8-16(15)13-18;1-2-9-10(11(14)17-12(15)16-9)7-3-5-8(13)6-4-7/h3-13H,1-2H3;3-6H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | XETXHOJZOYQXDK-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.14 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|