(11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid

C20H30O2 — CID 87843466

IUPAC(11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid
SMILESCC/C=C/C/C=C/C/C=C/CCCC=C=CCCCC(=O)O
InChIInChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,14,16H,2,5,8,11-13,17-19H2,1H3,(H,21,22)/b4-3+,7-6+,10-9+
InChIKeyBTADIBYPACMUQE-IUQGRGSQSA-N
MW302.46 g/mol
LogP5.98
Rot. Bonds13

About (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid

(11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid (PubChem CID 87843466) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid.

Molecular Properties

Compound Name(11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid
PubChem CID87843466
Molecular FormulaC20H30O2
Molecular Weight302.46 g/mol
Exact Mass302.22
IUPAC Name(11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid
SMILESCC/C=C/C/C=C/C/C=C/CCCC=C=CCCCC(=O)O
InChIInChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,14,16H,2,5,8,11-13,17-19H2,1H3,(H,21,22)/b4-3+,7-6+,10-9+
InChIKeyBTADIBYPACMUQE-IUQGRGSQSA-N
XLogP5.98
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds13
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500302.46
LogP ≤ 55.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid?
The IUPAC name of (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid (CID 87843466) is (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid.
What is the SMILES notation for (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid?
The canonical SMILES for (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid is CC/C=C/C/C=C/C/C=C/CCCC=C=CCCCC(=O)O.
What is the InChIKey of (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid?
The InChIKey is BTADIBYPACMUQE-IUQGRGSQSA-N. The full InChI is InChI=1S/C20H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h3-4,6-7,9-10,14,16H,2,5,8,11-13,17-19H2,1H3,(H,21,22)/b4-3+,7-6+,10-9+.
What are the key properties of (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid?
(11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid has a molecular weight of 302.46 g/mol, XLogP of 5.98, 13 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (11E,14E,17E)-icosa-5,6,11,14,17-pentaenoic acid is sourced from PubChem (CID 87843466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).