C25H44O12 — CID 87846797
[2,2-bis(ethoxymethyl)-3-[6-(2-hydroxyacetyl)oxyhexanoyloxy]propyl] 6-(2-hydroxyacetyl)oxyhexanoate (PubChem CID 87846797) has the molecular formula C25H44O12 and a molecular weight of 536.62 g/mol. Its IUPAC name is [2,2-bis(ethoxymethyl)-3-[6-(2-hydroxyacetyl)oxyhexanoyloxy]propyl] 6-(2-hydroxyacetyl)oxyhexanoate.
| Compound Name | [2,2-bis(ethoxymethyl)-3-[6-(2-hydroxyacetyl)oxyhexanoyloxy]propyl] 6-(2-hydroxyacetyl)oxyhexanoate |
|---|---|
| PubChem CID | 87846797 |
| Molecular Formula | C25H44O12 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | [2,2-bis(ethoxymethyl)-3-[6-(2-hydroxyacetyl)oxyhexanoyloxy]propyl] 6-(2-hydroxyacetyl)oxyhexanoate |
| SMILES | CCOCC(COCC)(COC(=O)CCCCCOC(=O)CO)COC(=O)CCCCCOC(=O)CO |
| InChI | InChI=1S/C25H44O12/c1-3-32-17-25(18-33-4-2,19-36-21(28)11-7-5-9-13-34-23(30)15-26)20-37-22(29)12-8-6-10-14-35-24(31)16-27/h26-27H,3-20H2,1-2H3 |
| InChIKey | BOFJSMWMYMPKFW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|