C22H20N4O2S — CID 87850179
N-[2-benzylsulfanyl-3-(cyanomethylamino)-3-oxopropyl]quinoline-3-carboxamide (PubChem CID 87850179) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[2-benzylsulfanyl-3-(cyanomethylamino)-3-oxopropyl]quinoline-3-carboxamide.
| Compound Name | N-[2-benzylsulfanyl-3-(cyanomethylamino)-3-oxopropyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 87850179 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[2-benzylsulfanyl-3-(cyanomethylamino)-3-oxopropyl]quinoline-3-carboxamide |
| SMILES | N#CCNC(=O)C(CNC(=O)c1cnc2ccccc2c1)SCc1ccccc1 |
| InChI | InChI=1S/C22H20N4O2S/c23-10-11-24-22(28)20(29-15-16-6-2-1-3-7-16)14-26-21(27)18-12-17-8-4-5-9-19(17)25-13-18/h1-9,12-13,20H,11,14-15H2,(H,24,28)(H,26,27) |
| InChIKey | NHWXCYFAZBHJJN-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|