C17H18O3 — CID 87852503
2,2-dimethyl-7,8,11-trioxatricyclo[10.2.2.23,6]octadeca-1(14),3(18),4,6(17),12,15-hexaene (PubChem CID 87852503) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2,2-dimethyl-7,8,11-trioxatricyclo[10.2.2.23,6]octadeca-1(14),3(18),4,6(17),12,15-hexaene.
| Compound Name | 2,2-dimethyl-7,8,11-trioxatricyclo[10.2.2.23,6]octadeca-1(14),3(18),4,6(17),12,15-hexaene |
|---|---|
| PubChem CID | 87852503 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2,2-dimethyl-7,8,11-trioxatricyclo[10.2.2.23,6]octadeca-1(14),3(18),4,6(17),12,15-hexaene |
| SMILES | CC1(C)c2ccc(cc2)OCCOOc2ccc1cc2 |
| InChI | InChI=1S/C17H18O3/c1-17(2)13-3-7-15(8-4-13)18-11-12-19-20-16-9-5-14(17)6-10-16/h3-10H,11-12H2,1-2H3 |
| InChIKey | VWIAUDSMERGULK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|