C18H12F3NO3 — CID 87855003
2-[1-(3,4-difluorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetaldehyde (PubChem CID 87855003) has the molecular formula C18H12F3NO3 and a molecular weight of 347.29 g/mol. Its IUPAC name is 2-[1-(3,4-difluorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetaldehyde.
| Compound Name | 2-[1-(3,4-difluorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 87855003 |
| Molecular Formula | C18H12F3NO3 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-[1-(3,4-difluorobenzoyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetaldehyde |
| SMILES | Cc1c(CC=O)c2cc(O)c(F)cc2n1C(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H12F3NO3/c1-9-11(4-5-23)12-7-17(24)15(21)8-16(12)22(9)18(25)10-2-3-13(19)14(20)6-10/h2-3,5-8,24H,4H2,1H3 |
| InChIKey | JWSXHQVXTHLHPK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|