C16H11ClFNO3S — CID 88938751
2-[1-(5-chlorothiophene-2-carbonyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetaldehyde (PubChem CID 88938751) has the molecular formula C16H11ClFNO3S and a molecular weight of 351.79 g/mol. Its IUPAC name is 2-[1-(5-chlorothiophene-2-carbonyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetaldehyde.
| Compound Name | 2-[1-(5-chlorothiophene-2-carbonyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 88938751 |
| Molecular Formula | C16H11ClFNO3S |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 2-[1-(5-chlorothiophene-2-carbonyl)-6-fluoro-5-hydroxy-2-methylindol-3-yl]acetaldehyde |
| SMILES | Cc1c(CC=O)c2cc(O)c(F)cc2n1C(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H11ClFNO3S/c1-8-9(4-5-20)10-6-13(21)11(18)7-12(10)19(8)16(22)14-2-3-15(17)23-14/h2-3,5-7,21H,4H2,1H3 |
| InChIKey | AYIUJWNWMVEKBB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|