C21H19N5OS2 — CID 87858708
N-(2-aminophenyl)-4-[(2-pyridin-2-yl-2,3-dihydro-1,3,4-thiadiazol-5-yl)-sulfanylmethyl]benzamide (PubChem CID 87858708) has the molecular formula C21H19N5OS2 and a molecular weight of 421.55 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(2-pyridin-2-yl-2,3-dihydro-1,3,4-thiadiazol-5-yl)-sulfanylmethyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(2-pyridin-2-yl-2,3-dihydro-1,3,4-thiadiazol-5-yl)-sulfanylmethyl]benzamide |
|---|---|
| PubChem CID | 87858708 |
| Molecular Formula | C21H19N5OS2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N-(2-aminophenyl)-4-[(2-pyridin-2-yl-2,3-dihydro-1,3,4-thiadiazol-5-yl)-sulfanylmethyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(S)C2=NNC(c3ccccn3)S2)cc1 |
| InChI | InChI=1S/C21H19N5OS2/c22-15-5-1-2-6-16(15)24-19(27)14-10-8-13(9-11-14)18(28)21-26-25-20(29-21)17-7-3-4-12-23-17/h1-12,18,20,25,28H,22H2,(H,24,27) |
| InChIKey | FWHVWUFWSFRIIQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|