C21H32O4 — CID 87860867
(3,6-dibutyl-4-cyclohexyl-2-hydroxyphenyl) hydrogen carbonate (PubChem CID 87860867) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (3,6-dibutyl-4-cyclohexyl-2-hydroxyphenyl) hydrogen carbonate.
| Compound Name | (3,6-dibutyl-4-cyclohexyl-2-hydroxyphenyl) hydrogen carbonate |
|---|---|
| PubChem CID | 87860867 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (3,6-dibutyl-4-cyclohexyl-2-hydroxyphenyl) hydrogen carbonate |
| SMILES | CCCCc1cc(C2CCCCC2)c(CCCC)c(O)c1OC(=O)O |
| InChI | InChI=1S/C21H32O4/c1-3-5-10-16-14-18(15-11-8-7-9-12-15)17(13-6-4-2)19(22)20(16)25-21(23)24/h14-15,22H,3-13H2,1-2H3,(H,23,24) |
| InChIKey | DHYYEBPUWGWOPD-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|