C25H23ClFN2O+ — CID 87862502
(5-chloro-1-phenylspiro[2H-indol-1-ium-3,4'-piperidine]-1-yl)-(2-fluorophenyl)methanone (PubChem CID 87862502) has the molecular formula C25H23ClFN2O+ and a molecular weight of 421.92 g/mol. Its IUPAC name is (5-chloro-1-phenylspiro[2H-indol-1-ium-3,4'-piperidine]-1-yl)-(2-fluorophenyl)methanone.
| Compound Name | (5-chloro-1-phenylspiro[2H-indol-1-ium-3,4'-piperidine]-1-yl)-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 87862502 |
| Molecular Formula | C25H23ClFN2O+ |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (5-chloro-1-phenylspiro[2H-indol-1-ium-3,4'-piperidine]-1-yl)-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)[N+]1(c2ccccc2)CC2(CCNCC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H23ClFN2O/c26-18-10-11-23-21(16-18)25(12-14-28-15-13-25)17-29(23,19-6-2-1-3-7-19)24(30)20-8-4-5-9-22(20)27/h1-11,16,28H,12-15,17H2/q+1 |
| InChIKey | NQPADFWGTJFASP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|