C22H24FN2O2+ — CID 87890410
(2-fluorophenyl)-(5-hydroxy-1-prop-2-enylspiro[2H-indol-1-ium-3,4'-piperidine]-1-yl)methanone (PubChem CID 87890410) has the molecular formula C22H24FN2O2+ and a molecular weight of 367.44 g/mol. Its IUPAC name is (2-fluorophenyl)-(5-hydroxy-1-prop-2-enylspiro[2H-indol-1-ium-3,4'-piperidine]-1-yl)methanone.
| Compound Name | (2-fluorophenyl)-(5-hydroxy-1-prop-2-enylspiro[2H-indol-1-ium-3,4'-piperidine]-1-yl)methanone |
|---|---|
| PubChem CID | 87890410 |
| Molecular Formula | C22H24FN2O2+ |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (2-fluorophenyl)-(5-hydroxy-1-prop-2-enylspiro[2H-indol-1-ium-3,4'-piperidine]-1-yl)methanone |
| SMILES | C=CC[N+]1(C(=O)c2ccccc2F)CC2(CCNCC2)c2cc(O)ccc21 |
| InChI | InChI=1S/C22H23FN2O2/c1-2-13-25(21(27)17-5-3-4-6-19(17)23)15-22(9-11-24-12-10-22)18-14-16(26)7-8-20(18)25/h2-8,14,24H,1,9-13,15H2/p+1 |
| InChIKey | IMUYDFHKJMJEMO-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|