C23H25F2N2O+ — CID 87890511
[1-(cyclopropylmethyl)-5-fluorospiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(4-fluorophenyl)methanone (PubChem CID 87890511) has the molecular formula C23H25F2N2O+ and a molecular weight of 383.46 g/mol. Its IUPAC name is [1-(cyclopropylmethyl)-5-fluorospiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-(cyclopropylmethyl)-5-fluorospiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 87890511 |
| Molecular Formula | C23H25F2N2O+ |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | [1-(cyclopropylmethyl)-5-fluorospiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)[N+]1(CC2CC2)CC2(CCNCC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C23H25F2N2O/c24-18-5-3-17(4-6-18)22(28)27(14-16-1-2-16)15-23(9-11-26-12-10-23)20-13-19(25)7-8-21(20)27/h3-8,13,16,26H,1-2,9-12,14-15H2/q+1 |
| InChIKey | QUXNSJMBVRQTTC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|