C25H22Cl2FN2O+ — CID 87862478
[5-chloro-1-(2-chlorophenyl)spiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(2-fluorophenyl)methanone (PubChem CID 87862478) has the molecular formula C25H22Cl2FN2O+ and a molecular weight of 456.37 g/mol. Its IUPAC name is [5-chloro-1-(2-chlorophenyl)spiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [5-chloro-1-(2-chlorophenyl)spiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 87862478 |
| Molecular Formula | C25H22Cl2FN2O+ |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [5-chloro-1-(2-chlorophenyl)spiro[2H-indol-1-ium-3,4'-piperidine]-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)[N+]1(c2ccccc2Cl)CC2(CCNCC2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H22Cl2FN2O/c26-17-9-10-22-19(15-17)25(11-13-29-14-12-25)16-30(22,23-8-4-2-6-20(23)27)24(31)18-5-1-3-7-21(18)28/h1-10,15,29H,11-14,16H2/q+1 |
| InChIKey | KYSIDLZXTAFLCE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|