C4H4O4 — CID 87866056
1-hydroxypropa-1,2-dienyl hydrogen carbonate (PubChem CID 87866056) has the molecular formula C4H4O4 and a molecular weight of 116.07 g/mol. Its IUPAC name is 1-hydroxypropa-1,2-dienyl hydrogen carbonate.
| Compound Name | 1-hydroxypropa-1,2-dienyl hydrogen carbonate |
|---|---|
| PubChem CID | 87866056 |
| Molecular Formula | C4H4O4 |
| Molecular Weight | 116.07 g/mol |
| Exact Mass | 116.01 |
| IUPAC Name | 1-hydroxypropa-1,2-dienyl hydrogen carbonate |
| SMILES | C=C=C(O)OC(=O)O |
| InChI | InChI=1S/C4H4O4/c1-2-3(5)8-4(6)7/h5H,1H2,(H,6,7) |
| InChIKey | PQQJTCQEZMTSLI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.07 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|