C28H31F6N7 — CID 87869336
8-(2-piperidin-1-ylethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 87869336) has the molecular formula C28H31F6N7 and a molecular weight of 579.59 g/mol. Its IUPAC name is 8-(2-piperidin-1-ylethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 8-(2-piperidin-1-ylethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 87869336 |
| Molecular Formula | C28H31F6N7 |
| Molecular Weight | 579.59 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | 8-(2-piperidin-1-ylethyl)-4-N-[4-(trifluoromethyl)phenyl]-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | Nc1nc2c(c(Nc3ccc(C(F)(F)F)cc3)n1)CCN(c1ncccc1C(F)(F)F)C(CCN1CCCCC1)C2 |
| InChI | InChI=1S/C28H31F6N7/c29-27(30,31)18-6-8-19(9-7-18)37-24-21-11-16-41(25-22(28(32,33)34)5-4-12-36-25)20(17-23(21)38-26(35)39-24)10-15-40-13-2-1-3-14-40/h4-9,12,20H,1-3,10-11,13-17H2,(H3,35,37,38,39) |
| InChIKey | WHPXMDJCMBXFPR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |