C19H28N6O3 — CID 87870995
N-[2-(diaminomethylideneamino)oxyethyl]-2-[4-methyl-6-oxo-1-(2-phenylethylamino)-2,3-dihydropyridin-5-yl]acetamide (PubChem CID 87870995) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)oxyethyl]-2-[4-methyl-6-oxo-1-(2-phenylethylamino)-2,3-dihydropyridin-5-yl]acetamide.
| Compound Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[4-methyl-6-oxo-1-(2-phenylethylamino)-2,3-dihydropyridin-5-yl]acetamide |
|---|---|
| PubChem CID | 87870995 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | N-[2-(diaminomethylideneamino)oxyethyl]-2-[4-methyl-6-oxo-1-(2-phenylethylamino)-2,3-dihydropyridin-5-yl]acetamide |
| SMILES | CC1=C(CC(=O)NCCON=C(N)N)C(=O)N(NCCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N6O3/c1-14-8-11-25(23-9-7-15-5-3-2-4-6-15)18(27)16(14)13-17(26)22-10-12-28-24-19(20)21/h2-6,23H,7-13H2,1H3,(H,22,26)(H4,20,21,24) |
| InChIKey | UJQBWLFBASGQLK-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 135.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|