C9H18F3N2O4P — CID 87871891
ethyl 2-[[2-aminoethyl(1,1,2-trifluoroethoxy)phosphoryl]amino]propanoate (PubChem CID 87871891) has the molecular formula C9H18F3N2O4P and a molecular weight of 306.22 g/mol. Its IUPAC name is ethyl 2-[[2-aminoethyl(1,1,2-trifluoroethoxy)phosphoryl]amino]propanoate.
| Compound Name | ethyl 2-[[2-aminoethyl(1,1,2-trifluoroethoxy)phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 87871891 |
| Molecular Formula | C9H18F3N2O4P |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | ethyl 2-[[2-aminoethyl(1,1,2-trifluoroethoxy)phosphoryl]amino]propanoate |
| SMILES | CCOC(=O)C(C)NP(=O)(CCN)OC(F)(F)CF |
| InChI | InChI=1S/C9H18F3N2O4P/c1-3-17-8(15)7(2)14-19(16,5-4-13)18-9(11,12)6-10/h7H,3-6,13H2,1-2H3,(H,14,16) |
| InChIKey | MWNULENVSHGFBS-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|