C32H52N2NiSi2 — CID 87876556
5-N,6-N-bis[3-(2-trimethylsilylethyl)phenyl]decane-5,6-diimine;nickel (PubChem CID 87876556) has the molecular formula C32H52N2NiSi2 and a molecular weight of 579.65 g/mol. Its IUPAC name is 5-N,6-N-bis[3-(2-trimethylsilylethyl)phenyl]decane-5,6-diimine;nickel.
| Compound Name | 5-N,6-N-bis[3-(2-trimethylsilylethyl)phenyl]decane-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87876556 |
| Molecular Formula | C32H52N2NiSi2 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | 5-N,6-N-bis[3-(2-trimethylsilylethyl)phenyl]decane-5,6-diimine;nickel |
| SMILES | CCCCC(=N\c1cccc(CC[Si](C)(C)C)c1)/C(CCCC)=N/c1cccc(CC[Si](C)(C)C)c1.[Ni] |
| InChI | InChI=1S/C32H52N2Si2.Ni/c1-9-11-19-31(33-29-17-13-15-27(25-29)21-23-35(3,4)5)32(20-12-10-2)34-30-18-14-16-28(26-30)22-24-36(6,7)8;/h13-18,25-26H,9-12,19-24H2,1-8H3;/b33-31+,34-32+; |
| InChIKey | UPLDWHWVMBRIEQ-KQOFJJDPSA-N |
| XLogP | 10.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|