About nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline
nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline (PubChem CID 87876930) has the molecular formula C30H46N4Ni
and a molecular weight of 521.42 g/mol. Its IUPAC name is nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline.
Molecular Properties
| Compound Name | nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline |
| PubChem CID | 87876930 |
| Molecular Formula | C30H46N4Ni |
| Molecular Weight | 521.42 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline |
| SMILES | CCCCCCCCNc1cccc(/N=C/C=N/c2cccc(NCCCCCCCC)c2)c1.[Ni] |
| InChI | InChI=1S/C30H46N4.Ni/c1-3-5-7-9-11-13-21-31-27-17-15-19-29(25-27)33-23-24-34-30-20-16-18-28(26-30)32-22-14-12-10-8-6-4-2;/h15-20,23-26,31-32H,3-14,21-22H2,1-2H3;/b33-23+,34-24+; |
| InChIKey | RFWSXPJPZMDJSJ-KKSXEPMBSA-N |
| XLogP | 9.33 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.42 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline?
The IUPAC name of nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline (CID 87876930) is nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline.
What is the SMILES notation for nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline?
The canonical SMILES for nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline is CCCCCCCCNc1cccc(/N=C/C=N/c2cccc(NCCCCCCCC)c2)c1.[Ni].
What is the InChIKey of nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline?
The InChIKey is RFWSXPJPZMDJSJ-KKSXEPMBSA-N. The full InChI is InChI=1S/C30H46N4.Ni/c1-3-5-7-9-11-13-21-31-27-17-15-19-29(25-27)33-23-24-34-30-20-16-18-28(26-30)32-22-14-12-10-8-6-4-2;/h15-20,23-26,31-32H,3-14,21-22H2,1-2H3;/b33-23+,34-24+;.
What are the key properties of nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline?
nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline has a molecular weight of 521.42 g/mol, XLogP of 9.33, 19 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;N-octyl-3-[2-[3-(octylamino)phenyl]iminoethylideneamino]aniline is sourced from PubChem (CID 87876930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).