C19H26N6O7S — CID 87877470
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid (PubChem CID 87877470) has the molecular formula C19H26N6O7S and a molecular weight of 482.52 g/mol. Its IUPAC name is 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid.
| Compound Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid |
|---|---|
| PubChem CID | 87877470 |
| Molecular Formula | C19H26N6O7S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoic acid;2-(3,7-dimethyl-2,6-dioxopurin-1-yl)acetic acid |
| SMILES | Cn1cnc2c1c(=O)n(CC(=O)O)c(=O)n2C.O=C(O)CCCC[C@@H]1SC[C@@H]2NC(=O)N[C@@H]21 |
| InChI | InChI=1S/C10H16N2O3S.C9H10N4O4/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9;1-11-4-10-7-6(11)8(16)13(3-5(14)15)9(17)12(7)2/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15);4H,3H2,1-2H3,(H,14,15)/t6-,7-,9-;/m0./s1 |
| InChIKey | YQVDNXGGPHSDHP-UFLZEWODSA-N |
| XLogP | -0.68 |
| TPSA | 177.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|