C20H24N3O6P — CID 87891661
(4S)-4-amino-5-(3-diphenoxyphosphoryl-1,2-oxazolidin-2-yl)-5-oxopentanamide (PubChem CID 87891661) has the molecular formula C20H24N3O6P and a molecular weight of 433.40 g/mol. Its IUPAC name is (4S)-4-amino-5-(3-diphenoxyphosphoryl-1,2-oxazolidin-2-yl)-5-oxopentanamide.
| Compound Name | (4S)-4-amino-5-(3-diphenoxyphosphoryl-1,2-oxazolidin-2-yl)-5-oxopentanamide |
|---|---|
| PubChem CID | 87891661 |
| Molecular Formula | C20H24N3O6P |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | (4S)-4-amino-5-(3-diphenoxyphosphoryl-1,2-oxazolidin-2-yl)-5-oxopentanamide |
| SMILES | NC(=O)CC[C@H](N)C(=O)N1OCCC1P(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C20H24N3O6P/c21-17(11-12-18(22)24)20(25)23-19(13-14-27-23)30(26,28-15-7-3-1-4-8-15)29-16-9-5-2-6-10-16/h1-10,17,19H,11-14,21H2,(H2,22,24)/t17-,19?/m0/s1 |
| InChIKey | XJAVGYZVRPMTGF-KKFHFHRHSA-N |
| XLogP | 2.42 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|