C20H20F7NO2 — CID 87891734
4-amino-4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluoro-2-methylphenyl)butan-2-ol (PubChem CID 87891734) has the molecular formula C20H20F7NO2 and a molecular weight of 439.37 g/mol. Its IUPAC name is 4-amino-4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluoro-2-methylphenyl)butan-2-ol.
| Compound Name | 4-amino-4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluoro-2-methylphenyl)butan-2-ol |
|---|---|
| PubChem CID | 87891734 |
| Molecular Formula | C20H20F7NO2 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 4-amino-4-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-2-(4-fluoro-2-methylphenyl)butan-2-ol |
| SMILES | Cc1cc(F)ccc1C(C)(O)CC(N)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H20F7NO2/c1-11-5-15(21)3-4-16(11)18(2,29)9-17(28)30-10-12-6-13(19(22,23)24)8-14(7-12)20(25,26)27/h3-8,17,29H,9-10,28H2,1-2H3 |
| InChIKey | LEMJLYLBLGBGPE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|