C35H39ClN4O12 — CID 87892122
3-[1-(4-chlorophenyl)propan-2-yl]phthalate;bis([1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]azanium) (PubChem CID 87892122) has the molecular formula C35H39ClN4O12 and a molecular weight of 743.17 g/mol. Its IUPAC name is 3-[1-(4-chlorophenyl)propan-2-yl]phthalate;bis([1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]azanium).
| Compound Name | 3-[1-(4-chlorophenyl)propan-2-yl]phthalate;bis([1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]azanium) |
|---|---|
| PubChem CID | 87892122 |
| Molecular Formula | C35H39ClN4O12 |
| Molecular Weight | 743.17 g/mol |
| Exact Mass | 742.23 |
| IUPAC Name | 3-[1-(4-chlorophenyl)propan-2-yl]phthalate;bis([1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]azanium) |
| SMILES | CC(Cc1ccc(Cl)cc1)c1cccc(C(=O)[O-])c1C(=O)[O-].[NH3+]C(CO)C(O)c1ccc([N+](=O)[O-])cc1.[NH3+]C(CO)C(O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15ClO4.2C9H12N2O4/c1-10(9-11-5-7-12(18)8-6-11)13-3-2-4-14(16(19)20)15(13)17(21)22;2*10-8(5-12)9(13)6-1-3-7(4-2-6)11(14)15/h2-8,10H,9H2,1H3,(H,19,20)(H,21,22);2*1-4,8-9,12-13H,5,10H2 |
| InChIKey | KVICHKUTIIOVNM-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 302.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|