C19H19ClN2O5 — CID 8025454
1-(4-chlorophenyl)-3-[(1S,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]iminobutan-1-one (PubChem CID 8025454) has the molecular formula C19H19ClN2O5 and a molecular weight of 390.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1S,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]iminobutan-1-one.
| Compound Name | 1-(4-chlorophenyl)-3-[(1S,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]iminobutan-1-one |
|---|---|
| PubChem CID | 8025454 |
| Molecular Formula | C19H19ClN2O5 |
| Molecular Weight | 390.82 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1S,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]iminobutan-1-one |
| SMILES | C/C(CC(=O)c1ccc(Cl)cc1)=N\[C@H](CO)[C@@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19ClN2O5/c1-12(10-18(24)13-2-6-15(20)7-3-13)21-17(11-23)19(25)14-4-8-16(9-5-14)22(26)27/h2-9,17,19,23,25H,10-11H2,1H3/b21-12+/t17-,19+/m1/s1 |
| InChIKey | SUXAIEPVFQAIKC-PGRHHKCQSA-N |
| XLogP | 3.38 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.82 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|