C13H15NO — CID 87893878
1-(3-isocyanatopropyl)-3-prop-1-en-2-ylbenzene (PubChem CID 87893878) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(3-isocyanatopropyl)-3-prop-1-en-2-ylbenzene.
| Compound Name | 1-(3-isocyanatopropyl)-3-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 87893878 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-(3-isocyanatopropyl)-3-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cccc(CCCN=C=O)c1 |
| InChI | InChI=1S/C13H15NO/c1-11(2)13-7-3-5-12(9-13)6-4-8-14-10-15/h3,5,7,9H,1,4,6,8H2,2H3 |
| InChIKey | OQBBGRMDSJRUMQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|