C31H40 — CID 143636343
2,6-dimethylhepta-2,5-diene;1-prop-1-en-2-yl-2-[4-(3-prop-1-en-2-ylphenyl)but-1-en-2-yl]benzene (PubChem CID 143636343) has the molecular formula C31H40 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2,6-dimethylhepta-2,5-diene;1-prop-1-en-2-yl-2-[4-(3-prop-1-en-2-ylphenyl)but-1-en-2-yl]benzene.
| Compound Name | 2,6-dimethylhepta-2,5-diene;1-prop-1-en-2-yl-2-[4-(3-prop-1-en-2-ylphenyl)but-1-en-2-yl]benzene |
|---|---|
| PubChem CID | 143636343 |
| Molecular Formula | C31H40 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.31 |
| IUPAC Name | 2,6-dimethylhepta-2,5-diene;1-prop-1-en-2-yl-2-[4-(3-prop-1-en-2-ylphenyl)but-1-en-2-yl]benzene |
| SMILES | C=C(C)c1cccc(CCC(=C)c2ccccc2C(=C)C)c1.CC(C)=CCC=C(C)C |
| InChI | InChI=1S/C22H24.C9H16/c1-16(2)20-10-8-9-19(15-20)14-13-18(5)22-12-7-6-11-21(22)17(3)4;1-8(2)6-5-7-9(3)4/h6-12,15H,1,3,5,13-14H2,2,4H3;6-7H,5H2,1-4H3 |
| InChIKey | ZTUAAQZRLRFFIQ-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|