C24H32ClN3 — CID 142077405
1-chloro-3,5-dimethylbenzene;N'-[5-(3-prop-1-en-2-ylphenyl)pent-1-en-2-ylamino]ethanimidamide (PubChem CID 142077405) has the molecular formula C24H32ClN3 and a molecular weight of 397.99 g/mol. Its IUPAC name is 1-chloro-3,5-dimethylbenzene;N'-[5-(3-prop-1-en-2-ylphenyl)pent-1-en-2-ylamino]ethanimidamide.
| Compound Name | 1-chloro-3,5-dimethylbenzene;N'-[5-(3-prop-1-en-2-ylphenyl)pent-1-en-2-ylamino]ethanimidamide |
|---|---|
| PubChem CID | 142077405 |
| Molecular Formula | C24H32ClN3 |
| Molecular Weight | 397.99 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-chloro-3,5-dimethylbenzene;N'-[5-(3-prop-1-en-2-ylphenyl)pent-1-en-2-ylamino]ethanimidamide |
| SMILES | C=C(CCCc1cccc(C(=C)C)c1)N/N=C(\C)N.Cc1cc(C)cc(Cl)c1 |
| InChI | InChI=1S/C16H23N3.C8H9Cl/c1-12(2)16-10-6-9-15(11-16)8-5-7-13(3)18-19-14(4)17;1-6-3-7(2)5-8(9)4-6/h6,9-11,18H,1,3,5,7-8H2,2,4H3,(H2,17,19);3-5H,1-2H3 |
| InChIKey | XBZYFWOYPVMWSD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.99 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|